Products 63018-40-6

CAS 63018-40-6 is the registry number for Benz(A)anthracene-7-acetic acid methyl ester. Offered by: Biosynth. Available pack sizes: 250mg.

Structural formula: {0} (CAS {1})

Methyl 2-benzo[a]anthracen-7-ylacetate (CAS 63018-40-6) is a chemical compound with the molecular formula C21H16O2 and a molecular weight of 300.3 g/mol. IUPAC name: methyl 2-benzo[a]anthracen-7-ylacetate. InChIKey: NPXQCYDDEJLMFO-UHFFFAOYSA-N.

Identity
Molecular formulaC21H16O2
Molecular weight300.3 g/mol
IUPAC namemethyl 2-benzo[a]anthracen-7-ylacetate
InChIKeyNPXQCYDDEJLMFO-UHFFFAOYSA-N
SMILESCOC(=O)CC1=C2C=CC3=CC=CC=C3C2=CC4=CC=CC=C41

Computed by PubChem (NCBI)