CAS 2226849-22-3 is the registry number for 1,3-Dibenzoyl-5-methylbenzene, 98%, 98%. Offered by: Chemat. Available pack sizes: 1g.
(3-benzoyl-5-methylphenyl)-phenylmethanone (CAS 2226849-22-3) is a chemical compound with the molecular formula C21H16O2 and a molecular weight of 300.3 g/mol. IUPAC name: (3-benzoyl-5-methylphenyl)-phenylmethanone. InChIKey: VIVHHCKZCDOICK-UHFFFAOYSA-N.
| Molecular formula | C21H16O2 |
|---|---|
| Molecular weight | 300.3 g/mol |
| IUPAC name | (3-benzoyl-5-methylphenyl)-phenylmethanone |
| InChIKey | VIVHHCKZCDOICK-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)C(=O)C2=CC=CC=C2)C(=O)C3=CC=CC=C3 |
Computed by PubChem (NCBI)