Products 1623461-06-2
CAS 1623461-06-2 appears in our catalog under these names: 6-Amino-2-bromo-3-fluorobenzoic acid, 98%, 6-Amino-2-bromo-3-fluoro-benzoic acid, 95%. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 100mg.
6-amino-2-bromo-3-fluorobenzoic acid (CAS 1623461-06-2) is a chemical compound with the molecular formula C7H5BrFNO2 and a molecular weight of 234.02 g/mol. IUPAC name: 6-amino-2-bromo-3-fluorobenzoic acid. InChIKey: NTTSFEVYBCJKMS-UHFFFAOYSA-N.
| Molecular formula | C7H5BrFNO2 |
|---|---|
| Molecular weight | 234.02 g/mol |
| IUPAC name | 6-amino-2-bromo-3-fluorobenzoic acid |
| InChIKey | NTTSFEVYBCJKMS-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1N)C(=O)O)Br)F |
Computed by PubChem (NCBI)