CAS 1623780-52-8 is the registry number for (S)-1-(2,4-Dichlorophenyl)propane-1,3-diol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(2,4-dichlorophenyl)propane-1,3-diol (CAS 1623780-52-8) is a chemical compound with the molecular formula C9H10Cl2O2 and a molecular weight of 221.08 g/mol. IUPAC name: 1-(2,4-dichlorophenyl)propane-1,3-diol. InChIKey: MOOQBDRRMRDOHO-UHFFFAOYSA-N.
| Molecular formula | C9H10Cl2O2 |
|---|---|
| Molecular weight | 221.08 g/mol |
| IUPAC name | 1-(2,4-dichlorophenyl)propane-1,3-diol |
| InChIKey | MOOQBDRRMRDOHO-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C(CCO)O |
Computed by PubChem (NCBI)