Products 1624260-37-2
CAS 1624260-37-2 appears in our catalog under these names: Ethyl 2–(2–(dimethylamino)pyrimidin–4–yl)–1H–indole–5–carboxylate, Ethyl 2-(2-(dimethylamino)pyrimidin-4-yl)-1h-indole-5-carboxylate, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 250mg, 1g.
Ethyl 2-[2-(dimethylamino)pyrimidin-4-yl]-1H-indole-5-carboxylate (CAS 1624260-37-2) is a chemical compound with the molecular formula C17H18N4O2 and a molecular weight of 310.35 g/mol. IUPAC name: ethyl 2-[2-(dimethylamino)pyrimidin-4-yl]-1H-indole-5-carboxylate. InChIKey: JUNYLBOAWFCONB-UHFFFAOYSA-N.
| Molecular formula | C17H18N4O2 |
|---|---|
| Molecular weight | 310.35 g/mol |
| IUPAC name | ethyl 2-[2-(dimethylamino)pyrimidin-4-yl]-1H-indole-5-carboxylate |
| InChIKey | JUNYLBOAWFCONB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(C=C1)NC(=C2)C3=NC(=NC=C3)N(C)C |
Computed by PubChem (NCBI)