CAS 863485-46-5 appears in our catalog under these names: Hydroxymethyl Alosetron, Alosetron Impurity 4 (Hydroxymethyl Alosetron), Alosetron M5. Offered by: Chemat Brand, Hubei YoungXin, TRC. Available pack sizes: on request, 10mg, 25mg, 50mg, 100mg, 200mg.
2-[[4-(hydroxymethyl)-1H-imidazol-5-yl]methyl]-5-methyl-3,4-dihydropyrido[4,3-b]indol-1-one (CAS 863485-46-5) is a chemical compound with the molecular formula C17H18N4O2 and a molecular weight of 310.35 g/mol. IUPAC name: 2-[[4-(hydroxymethyl)-1H-imidazol-5-yl]methyl]-5-methyl-3,4-dihydropyrido[4,3-b]indol-1-one. InChIKey: JTJWYTFVXBYLLW-UHFFFAOYSA-N.
| Molecular formula | C17H18N4O2 |
|---|---|
| Molecular weight | 310.35 g/mol |
| IUPAC name | 2-[[4-(hydroxymethyl)-1H-imidazol-5-yl]methyl]-5-methyl-3,4-dihydropyrido[4,3-b]indol-1-one |
| InChIKey | JTJWYTFVXBYLLW-UHFFFAOYSA-N |
| SMILES | CN1C2=C(C3=CC=CC=C31)C(=O)N(CC2)CC4=C(N=CN4)CO |
Computed by PubChem (NCBI)