CAS 349638-38-6 is the registry number for N-(4-(2-(1-(3-Aminophenyl)ethylidene)hydrazine-1-carbonyl)phenyl)acetamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
4-acetamido-N-[(E)-1-(3-aminophenyl)ethylideneamino]benzamide (CAS 349638-38-6) is a chemical compound with the molecular formula C17H18N4O2 and a molecular weight of 310.35 g/mol. IUPAC name: 4-acetamido-N-[(E)-1-(3-aminophenyl)ethylideneamino]benzamide. InChIKey: MUVMHGMXURUXGE-RGVLZGJSSA-N.
| Molecular formula | C17H18N4O2 |
|---|---|
| Molecular weight | 310.35 g/mol |
| IUPAC name | 4-acetamido-N-[(E)-1-(3-aminophenyl)ethylideneamino]benzamide |
| InChIKey | MUVMHGMXURUXGE-RGVLZGJSSA-N |
| SMILES | C/C(=N\NC(=O)C1=CC=C(C=C1)NC(=O)C)/C2=CC(=CC=C2)N |
Computed by PubChem (NCBI)