CAS 1624261-01-3 appears in our catalog under these names: Mirabegron Impurity 27, (S)-2-((4-Aminophenethyl)amino)-1-phenylethanol. Offered by: Chemat Brand, Biosynth. Available pack sizes: on request, 25mg, 50mg, 100mg, 250mg, 500mg.
(1S)-2-[2-(4-aminophenyl)ethylamino]-1-phenylethanol (CAS 1624261-01-3) is a chemical compound with the molecular formula C16H20N2O and a molecular weight of 256.34 g/mol. IUPAC name: (1S)-2-[2-(4-aminophenyl)ethylamino]-1-phenylethanol. InChIKey: TUAHDMSPHZSMQN-MRXNPFEDSA-N.
| Molecular formula | C16H20N2O |
|---|---|
| Molecular weight | 256.34 g/mol |
| IUPAC name | (1S)-2-[2-(4-aminophenyl)ethylamino]-1-phenylethanol |
| InChIKey | TUAHDMSPHZSMQN-MRXNPFEDSA-N |
| SMILES | C1=CC=C(C=C1)[C@@H](CNCCC2=CC=C(C=C2)N)O |
Computed by PubChem (NCBI)