CAS 162490-88-2 is the registry number for (1S,3R,5R,7S) Sordidin. Offered by: TRC. Available pack sizes: 25mg.
(1S,3R,5R,7S)-1-ethyl-3,5,7-trimethyl-2,8-dioxabicyclo[3.2.1]octane (CAS 162490-88-2) is a chemical compound with the molecular formula C11H20O2 and a molecular weight of 184.27 g/mol. IUPAC name: (1S,3R,5R,7S)-1-ethyl-3,5,7-trimethyl-2,8-dioxabicyclo[3.2.1]octane. InChIKey: LOGJGKGBKZOEKZ-ZDCRXTMVSA-N.
| Molecular formula | C11H20O2 |
|---|---|
| Molecular weight | 184.27 g/mol |
| IUPAC name | (1S,3R,5R,7S)-1-ethyl-3,5,7-trimethyl-2,8-dioxabicyclo[3.2.1]octane |
| InChIKey | LOGJGKGBKZOEKZ-ZDCRXTMVSA-N |
| SMILES | CC[C@@]12[C@H](C[C@@](O1)(C[C@H](O2)C)C)C |
Computed by PubChem (NCBI)