CAS 16269-26-4 is the registry number for 2-Chloro-1(2H)-acenaphthylenone. Offered by: TRC. Available pack sizes: 100mg, 1g.
2-chloro-2H-acenaphthylen-1-one (CAS 16269-26-4) is a chemical compound with the molecular formula C12H7ClO and a molecular weight of 202.63 g/mol. IUPAC name: 2-chloro-2H-acenaphthylen-1-one. InChIKey: ANEWKHWKQARGCS-UHFFFAOYSA-N.
| Molecular formula | C12H7ClO |
|---|---|
| Molecular weight | 202.63 g/mol |
| IUPAC name | 2-chloro-2H-acenaphthylen-1-one |
| InChIKey | ANEWKHWKQARGCS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C3C(=C1)C(C(=O)C3=CC=C2)Cl |
Computed by PubChem (NCBI)