CAS 25074-67-3 appears in our catalog under these names: 3-Chlorodibenzo(b,d)furan, 95%, 3-Chlorodibenzo[b,d]furan, 95%, 95%. Offered by: AmBeed, Chemat. Available pack sizes: 1g, 5g, 25g.
3-chlorodibenzofuran (CAS 25074-67-3) is a chemical compound with the molecular formula C12H7ClO and a molecular weight of 202.63 g/mol. IUPAC name: 3-chlorodibenzofuran. InChIKey: BBOZMMAURMEVAR-UHFFFAOYSA-N.
| Molecular formula | C12H7ClO |
|---|---|
| Molecular weight | 202.63 g/mol |
| IUPAC name | 3-chlorodibenzofuran |
| InChIKey | BBOZMMAURMEVAR-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C(O2)C=C(C=C3)Cl |
Computed by PubChem (NCBI)