CAS 37568-51-7 is the registry number for 5-Chloroacenaphthenone, >95% (HPLC). Offered by: TRC. Available pack sizes: 500mg, 50mg.
5-chloro-2H-acenaphthylen-1-one (CAS 37568-51-7) is a chemical compound with the molecular formula C12H7ClO and a molecular weight of 202.63 g/mol. IUPAC name: 5-chloro-2H-acenaphthylen-1-one. InChIKey: HWGYNKVSELKHQG-UHFFFAOYSA-N.
| Molecular formula | C12H7ClO |
|---|---|
| Molecular weight | 202.63 g/mol |
| IUPAC name | 5-chloro-2H-acenaphthylen-1-one |
| InChIKey | HWGYNKVSELKHQG-UHFFFAOYSA-N |
| SMILES | C1C2=C3C(=C(C=C2)Cl)C=CC=C3C1=O |
Computed by PubChem (NCBI)