Products 1627567-79-6
CAS 1627567-79-6 is the registry number for 4α-Hydroxybisabola-2,10-diene-1,9-dione. Offered by: MedChemExpress. Available pack sizes: Get quote.
(4R,6S)-4-hydroxy-3-methyl-6-(6-methyl-4-oxohept-5-en-2-yl)cyclohex-2-en-1-one (CAS 1627567-79-6) is a chemical compound with the molecular formula C15H22O3 and a molecular weight of 250.33 g/mol. IUPAC name: (4R,6S)-4-hydroxy-3-methyl-6-(6-methyl-4-oxohept-5-en-2-yl)cyclohex-2-en-1-one. InChIKey: OSRRMTFNESOFIG-INPHSSGZSA-N.
| Molecular formula | C15H22O3 |
|---|---|
| Molecular weight | 250.33 g/mol |
| IUPAC name | (4R,6S)-4-hydroxy-3-methyl-6-(6-methyl-4-oxohept-5-en-2-yl)cyclohex-2-en-1-one |
| InChIKey | OSRRMTFNESOFIG-INPHSSGZSA-N |
| SMILES | CC1=CC(=O)[C@@H](C[C@H]1O)C(C)CC(=O)C=C(C)C |
Computed by PubChem (NCBI)