Products 162797-35-5
CAS 162797-35-5 is the registry number for Paeciloquinone D. Offered by: MedChemExpress. Available pack sizes: Get quote.
4-hydroxy-2-(1,3,6,8-tetrahydroxy-9,10-dioxoanthracen-2-yl)butanoic acid (CAS 162797-35-5) is a chemical compound with the molecular formula C18H14O9 and a molecular weight of 374.3 g/mol. IUPAC name: 4-hydroxy-2-(1,3,6,8-tetrahydroxy-9,10-dioxoanthracen-2-yl)butanoic acid. InChIKey: NSSMDOWGNWOYJY-UHFFFAOYSA-N.
| Molecular formula | C18H14O9 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 4-hydroxy-2-(1,3,6,8-tetrahydroxy-9,10-dioxoanthracen-2-yl)butanoic acid |
| InChIKey | NSSMDOWGNWOYJY-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C1C(=O)C3=CC(=C(C(=C3C2=O)O)C(CCO)C(=O)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
Paeciloquinone D, orb3024682