CAS 79005-83-7 is the registry number for Phenol Related Compound 6. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2-(3,5-dihydroxyphenoxy)-3,5-dihydroxyphenoxy]benzene-1,3,5-triol (CAS 79005-83-7) is a chemical compound with the molecular formula C18H14O9 and a molecular weight of 374.3 g/mol. IUPAC name: 2-[2-(3,5-dihydroxyphenoxy)-3,5-dihydroxyphenoxy]benzene-1,3,5-triol. InChIKey: OXFVHFABBAINFL-UHFFFAOYSA-N.
| Molecular formula | C18H14O9 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 2-[2-(3,5-dihydroxyphenoxy)-3,5-dihydroxyphenoxy]benzene-1,3,5-triol |
| InChIKey | OXFVHFABBAINFL-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C=C1O)OC2=C(C=C(C=C2OC3=C(C=C(C=C3O)O)O)O)O)O |
Computed by PubChem (NCBI)