CAS 58878-18-5 is the registry number for Phenol Related Compound 3. Offered by: Chemat Brand. Available pack sizes: on request.
2-[2,6-dihydroxy-4-(2,4,6-trihydroxyphenoxy)phenyl]benzene-1,3,5-triol (CAS 58878-18-5) is a chemical compound with the molecular formula C18H14O9 and a molecular weight of 374.3 g/mol. IUPAC name: 2-[2,6-dihydroxy-4-(2,4,6-trihydroxyphenoxy)phenyl]benzene-1,3,5-triol. InChIKey: LXRUQARQPSVVEX-UHFFFAOYSA-N.
| Molecular formula | C18H14O9 |
|---|---|
| Molecular weight | 374.3 g/mol |
| IUPAC name | 2-[2,6-dihydroxy-4-(2,4,6-trihydroxyphenoxy)phenyl]benzene-1,3,5-triol |
| InChIKey | LXRUQARQPSVVEX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1O)C2=C(C=C(C=C2O)OC3=C(C=C(C=C3O)O)O)O)O)O |
Computed by PubChem (NCBI)