CAS 1628010-80-9 is the registry number for 2-Methyl-2-[3-(tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide, 97%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.
2-methyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide (CAS 1628010-80-9) is a chemical compound with the molecular formula C16H24BNO3 and a molecular weight of 289.2 g/mol. IUPAC name: 2-methyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide. InChIKey: SGCNEEWVAZOBSP-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO3 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | 2-methyl-2-[3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propanamide |
| InChIKey | SGCNEEWVAZOBSP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=CC=C2)C(C)(C)C(=O)N |
Computed by PubChem (NCBI)