Products 1628162-75-3
CAS 1628162-75-3 is the registry number for tert-Butyl (1R,5S)-2-oxo-3,8-diazabicyclo[3.2.1]octane-8-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g.
Tert-butyl (1R,5S)-2-oxo-3,8-diazabicyclo[3.2.1]octane-8-carboxylate (CAS 1628162-75-3) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: tert-butyl (1R,5S)-2-oxo-3,8-diazabicyclo[3.2.1]octane-8-carboxylate. InChIKey: OXGZIGAYYGRTHO-JGVFFNPUSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | tert-butyl (1R,5S)-2-oxo-3,8-diazabicyclo[3.2.1]octane-8-carboxylate |
| InChIKey | OXGZIGAYYGRTHO-JGVFFNPUSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2CC[C@@H]1C(=O)NC2 |
Computed by PubChem (NCBI)