CAS 1628174-84-4 is the registry number for (S)-4-(((1,4-Dioxan-2-yl)methyl)amino)-3-nitrobenzenesulfonamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-[[(2S)-1,4-dioxan-2-yl]methylamino]-3-nitrobenzenesulfonamide (CAS 1628174-84-4) is a chemical compound with the molecular formula C11H15N3O6S and a molecular weight of 317.32 g/mol. IUPAC name: 4-[[(2S)-1,4-dioxan-2-yl]methylamino]-3-nitrobenzenesulfonamide. InChIKey: RQTYXXLPLPXMNF-QMMMGPOBSA-N.
| Molecular formula | C11H15N3O6S |
|---|---|
| Molecular weight | 317.32 g/mol |
| IUPAC name | 4-[[(2S)-1,4-dioxan-2-yl]methylamino]-3-nitrobenzenesulfonamide |
| InChIKey | RQTYXXLPLPXMNF-QMMMGPOBSA-N |
| SMILES | C1CO[C@H](CO1)CNC2=C(C=C(C=C2)S(=O)(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)