CAS 851169-05-6 appears in our catalog under these names: (([4-(Isopropylamino)-3-nitrophenyl]sulfonyl)amino)acetic acid, 95%, 2-{3-nitro-4-((propan-2-yl)amino)benzenesulfonamido}acetic acid, 95%, 2-{3-Nitro-4-((propan-2-yl)amino)benzenesulfonamido}acetic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg, 0,5g.
2-[[3-nitro-4-(propan-2-ylamino)phenyl]sulfonylamino]acetic acid (CAS 851169-05-6) is a chemical compound with the molecular formula C11H15N3O6S and a molecular weight of 317.32 g/mol. IUPAC name: 2-[[3-nitro-4-(propan-2-ylamino)phenyl]sulfonylamino]acetic acid. InChIKey: QYSJOTGEGUHBTO-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O6S |
|---|---|
| Molecular weight | 317.32 g/mol |
| IUPAC name | 2-[[3-nitro-4-(propan-2-ylamino)phenyl]sulfonylamino]acetic acid |
| InChIKey | QYSJOTGEGUHBTO-UHFFFAOYSA-N |
| SMILES | CC(C)NC1=C(C=C(C=C1)S(=O)(=O)NCC(=O)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)