CAS 333440-71-4 is the registry number for 1-Boc-2-(4-nitrobenzenesulfonyl)hydrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 5g.
Tert-butyl N-[(4-nitrophenyl)sulfonylamino]carbamate (CAS 333440-71-4) is a chemical compound with the molecular formula C11H15N3O6S and a molecular weight of 317.32 g/mol. IUPAC name: tert-butyl N-[(4-nitrophenyl)sulfonylamino]carbamate. InChIKey: NOJCYFMYHGQHAM-UHFFFAOYSA-N.
| Molecular formula | C11H15N3O6S |
|---|---|
| Molecular weight | 317.32 g/mol |
| IUPAC name | tert-butyl N-[(4-nitrophenyl)sulfonylamino]carbamate |
| InChIKey | NOJCYFMYHGQHAM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NNS(=O)(=O)C1=CC=C(C=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)