CAS 1628539-97-8 appears in our catalog under these names: 3-Bromo-4-fluoro-5-iodobenzoic acid, 98%, 3-Bromo-4-fluoro-5-iodobenzoic acid, 95%, 95%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 100mg, 250mg, 1g.
3-bromo-4-fluoro-5-iodobenzoic acid (CAS 1628539-97-8) is a chemical compound with the molecular formula C7H3BrFIO2 and a molecular weight of 344.90 g/mol. IUPAC name: 3-bromo-4-fluoro-5-iodobenzoic acid. InChIKey: UFNYFGZMALWWQR-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFIO2 |
|---|---|
| Molecular weight | 344.90 g/mol |
| IUPAC name | 3-bromo-4-fluoro-5-iodobenzoic acid |
| InChIKey | UFNYFGZMALWWQR-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Br)F)I)C(=O)O |
Computed by PubChem (NCBI)