Products 217816-53-0
CAS 217816-53-0 appears in our catalog under these names: 6-Bromo-2-fluoro-3-iodobenzoic acid, 95%, 6-Bromo-2-fluoro-3-iodobenzoic acid, 95+%, 6-Bromo-2-fluoro-3-iodobenzoic acid, ≥98.9%, ≥98.9%, 6-Bromo-2-fluoro-3-iodobenzoic acid. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 25g.
6-bromo-2-fluoro-3-iodobenzoic acid (CAS 217816-53-0) is a chemical compound with the molecular formula C7H3BrFIO2 and a molecular weight of 344.90 g/mol. IUPAC name: 6-bromo-2-fluoro-3-iodobenzoic acid. InChIKey: FTGARIJZXXCFHE-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFIO2 |
|---|---|
| Molecular weight | 344.90 g/mol |
| IUPAC name | 6-bromo-2-fluoro-3-iodobenzoic acid |
| InChIKey | FTGARIJZXXCFHE-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1Br)C(=O)O)F)I |
Computed by PubChem (NCBI)