CAS 1870155-80-8 appears in our catalog under these names: 4-Bromo-5-fluoro-2-iodobenzoic acid 98%, 4-Bromo-5-fluoro-2-iodobenzoic acid, 98%, 98%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4-bromo-5-fluoro-2-iodobenzoic acid (CAS 1870155-80-8) is a chemical compound with the molecular formula C7H3BrFIO2 and a molecular weight of 344.90 g/mol. IUPAC name: 4-bromo-5-fluoro-2-iodobenzoic acid. InChIKey: PAGMQCQYZMJHSO-UHFFFAOYSA-N.
| Molecular formula | C7H3BrFIO2 |
|---|---|
| Molecular weight | 344.90 g/mol |
| IUPAC name | 4-bromo-5-fluoro-2-iodobenzoic acid |
| InChIKey | PAGMQCQYZMJHSO-UHFFFAOYSA-N |
| SMILES | C1=C(C(=CC(=C1F)Br)I)C(=O)O |
Computed by PubChem (NCBI)