CAS 1628860-77-4 is the registry number for 4-Bromo-N-hydroxy-3-methoxybenzimidamide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-bromo-N'-hydroxy-3-methoxybenzenecarboximidamide (CAS 1628860-77-4) is a chemical compound with the molecular formula C8H9BrN2O2 and a molecular weight of 245.07 g/mol. IUPAC name: 4-bromo-N'-hydroxy-3-methoxybenzenecarboximidamide. InChIKey: LXYOKQRGUOKFOV-UHFFFAOYSA-N.
| Molecular formula | C8H9BrN2O2 |
|---|---|
| Molecular weight | 245.07 g/mol |
| IUPAC name | 4-bromo-N'-hydroxy-3-methoxybenzenecarboximidamide |
| InChIKey | LXYOKQRGUOKFOV-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)C(=NO)N)Br |
Computed by PubChem (NCBI)