CAS 16289-13-7 appears in our catalog under these names: Chlortalidone (Chlorthalidone) EP Impurity G, Chloro Chlorthalidone, >95% (HPLC), Chlorthalidone Impurity G, Chlorthalidone Impurity G, DICHLORO CHLORTHALIDONE. Offered by: Chemat Brand, TRC, TargetMol, GLPBio, Biosynth. Available pack sizes: on request, 100mg, 10mg, 25mg, 1mg, 5mg, 500μg, 2mg.
3-(3,4-dichlorophenyl)-3-hydroxy-2H-isoindol-1-one (CAS 16289-13-7) is a chemical compound with the molecular formula C14H9Cl2NO2 and a molecular weight of 294.1 g/mol. IUPAC name: 3-(3,4-dichlorophenyl)-3-hydroxy-2H-isoindol-1-one. InChIKey: SXUJTBDUNKPITB-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2NO2 |
|---|---|
| Molecular weight | 294.1 g/mol |
| IUPAC name | 3-(3,4-dichlorophenyl)-3-hydroxy-2H-isoindol-1-one |
| InChIKey | SXUJTBDUNKPITB-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)NC2(C3=CC(=C(C=C3)Cl)Cl)O |
Computed by PubChem (NCBI)