CAS 73328-71-9 is the registry number for 1-(2,6-Dichloro-4-hydroxphenyl)-1,3-dihydroindol-2-one. Offered by: TRC. Available pack sizes: 10mg, 2mg, 5mg.
1-(2,6-dichloro-4-hydroxyphenyl)-3H-indol-2-one (CAS 73328-71-9) is a chemical compound with the molecular formula C14H9Cl2NO2 and a molecular weight of 294.1 g/mol. IUPAC name: 1-(2,6-dichloro-4-hydroxyphenyl)-3H-indol-2-one. InChIKey: QZGDFRBQDMINQA-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2NO2 |
|---|---|
| Molecular weight | 294.1 g/mol |
| IUPAC name | 1-(2,6-dichloro-4-hydroxyphenyl)-3H-indol-2-one |
| InChIKey | QZGDFRBQDMINQA-UHFFFAOYSA-N |
| SMILES | C1C2=CC=CC=C2N(C1=O)C3=C(C=C(C=C3Cl)O)Cl |
Computed by PubChem (NCBI)