CAS 568543-69-1 appears in our catalog under these names: 2,4-Dichloro-n-(3-formyl-phenyl)-benzamide, 95%, 2,4-Dichloro-N-(3-formylphenyl)benzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2,4-dichloro-N-(3-formylphenyl)benzamide (CAS 568543-69-1) is a chemical compound with the molecular formula C14H9Cl2NO2 and a molecular weight of 294.1 g/mol. IUPAC name: 2,4-dichloro-N-(3-formylphenyl)benzamide. InChIKey: NRMAEFLPESWJAK-UHFFFAOYSA-N.
| Molecular formula | C14H9Cl2NO2 |
|---|---|
| Molecular weight | 294.1 g/mol |
| IUPAC name | 2,4-dichloro-N-(3-formylphenyl)benzamide |
| InChIKey | NRMAEFLPESWJAK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)NC(=O)C2=C(C=C(C=C2)Cl)Cl)C=O |
Computed by PubChem (NCBI)