CAS 16292-88-9 appears in our catalog under these names: 3-Methoxy-4-nitroaniline, 98%, 3–Methoxy–4–nitroaniline, 3-Methoxy-4-nitroaniline 98%, 3-Methoxy-4-nitroaniline, 98%, 98%. Offered by: Combi-blocks, GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 10g, 25g, 100g, 5g, 1g, 250mg, 100mg, 50g.
3-methoxy-4-nitroaniline (CAS 16292-88-9) is a chemical compound with the molecular formula C7H8N2O3 and a molecular weight of 168.15 g/mol. IUPAC name: 3-methoxy-4-nitroaniline. InChIKey: JVUHWSGOORVDML-UHFFFAOYSA-N.
| Molecular formula | C7H8N2O3 |
|---|---|
| Molecular weight | 168.15 g/mol |
| IUPAC name | 3-methoxy-4-nitroaniline |
| InChIKey | JVUHWSGOORVDML-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)