CAS 16292-95-8 appears in our catalog under these names: 3-Methoxy-4-nitrophenol, 95%, 95%, 3-Methoxy-4-nitrophenol 95%, 3-Methoxy-4-nitrophenol, 95%, 3–Methoxy–4–nitrophenol. Offered by: Chemat, Ambeed, Fluorochem, GLPBio. Available pack sizes: 100g, 250mg, 1g, 5g, 10g, 25g.
3-methoxy-4-nitrophenol (CAS 16292-95-8) is a chemical compound with the molecular formula C7H7NO4 and a molecular weight of 169.13 g/mol. IUPAC name: 3-methoxy-4-nitrophenol. InChIKey: VDQSACYMBGQMFC-UHFFFAOYSA-N.
| Molecular formula | C7H7NO4 |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 3-methoxy-4-nitrophenol |
| InChIKey | VDQSACYMBGQMFC-UHFFFAOYSA-N |
| SMILES | COC1=C(C=CC(=C1)O)[N+](=O)[O-] |
Computed by PubChem (NCBI)