CAS 1629376-58-4 appears in our catalog under these names: Methyl 3-bromo-4-chloro-5-hydroxybenzoate 95%, Methyl 3-bromo-4-chloro-5-hydroxybenzoate, 95%, 95%. Offered by: Ambeed, Chemat. Available pack sizes: 100mg, 250mg, 1g.
Methyl 3-bromo-4-chloro-5-hydroxybenzoate (CAS 1629376-58-4) is a chemical compound with the molecular formula C8H6BrClO3 and a molecular weight of 265.49 g/mol. IUPAC name: methyl 3-bromo-4-chloro-5-hydroxybenzoate. InChIKey: CRCBFWBGQAYKMU-UHFFFAOYSA-N.
| Molecular formula | C8H6BrClO3 |
|---|---|
| Molecular weight | 265.49 g/mol |
| IUPAC name | methyl 3-bromo-4-chloro-5-hydroxybenzoate |
| InChIKey | CRCBFWBGQAYKMU-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=CC(=C(C(=C1)Br)Cl)O |
Computed by PubChem (NCBI)