Products 162938-44-5
CAS 162938-44-5 is the registry number for Ethyl 2-chloro-5-(trifluoromethyl)benzoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 250mg, 1g.
Ethyl 2-chloro-5-(trifluoromethyl)benzoate (CAS 162938-44-5) is a chemical compound with the molecular formula C10H8ClF3O2 and a molecular weight of 252.62 g/mol. IUPAC name: ethyl 2-chloro-5-(trifluoromethyl)benzoate. InChIKey: CQZVUPCGMGMCDD-UHFFFAOYSA-N.
| Molecular formula | C10H8ClF3O2 |
|---|---|
| Molecular weight | 252.62 g/mol |
| IUPAC name | ethyl 2-chloro-5-(trifluoromethyl)benzoate |
| InChIKey | CQZVUPCGMGMCDD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(C=CC(=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)