CAS 1629411-93-3 is the registry number for 2,4-Dichloro-7-methyl-5,7-dihydro-6H-pyrrolo[2,3-d]pyrimidin-6-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one (CAS 1629411-93-3) is a chemical compound with the molecular formula C7H5Cl2N3O and a molecular weight of 218.04 g/mol. IUPAC name: 2,4-dichloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one. InChIKey: AUGJAJROFKDBOP-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3O |
|---|---|
| Molecular weight | 218.04 g/mol |
| IUPAC name | 2,4-dichloro-7-methyl-5H-pyrrolo[2,3-d]pyrimidin-6-one |
| InChIKey | AUGJAJROFKDBOP-UHFFFAOYSA-N |
| SMILES | CN1C(=O)CC2=C1N=C(N=C2Cl)Cl |
Computed by PubChem (NCBI)