CAS 2730453-37-7 is the registry number for 5,7-Dichloro-2-methoxypyrazolo[1,5-a]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,7-dichloro-2-methoxypyrazolo[1,5-a]pyrimidine (CAS 2730453-37-7) is a chemical compound with the molecular formula C7H5Cl2N3O and a molecular weight of 218.04 g/mol. IUPAC name: 5,7-dichloro-2-methoxypyrazolo[1,5-a]pyrimidine. InChIKey: OTJIFDVDUWFJFX-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3O |
|---|---|
| Molecular weight | 218.04 g/mol |
| IUPAC name | 5,7-dichloro-2-methoxypyrazolo[1,5-a]pyrimidine |
| InChIKey | OTJIFDVDUWFJFX-UHFFFAOYSA-N |
| SMILES | COC1=NN2C(=C1)N=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)