CAS 2496-70-0 is the registry number for 3-(4,5-Dichloro-6-oxopyridazin-1(6H)-yl)propanenitrile, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4,5-dichloro-6-oxopyridazin-1-yl)propanenitrile (CAS 2496-70-0) is a chemical compound with the molecular formula C7H5Cl2N3O and a molecular weight of 218.04 g/mol. IUPAC name: 3-(4,5-dichloro-6-oxopyridazin-1-yl)propanenitrile. InChIKey: DNHNKXMDLJRGHR-UHFFFAOYSA-N.
| Molecular formula | C7H5Cl2N3O |
|---|---|
| Molecular weight | 218.04 g/mol |
| IUPAC name | 3-(4,5-dichloro-6-oxopyridazin-1-yl)propanenitrile |
| InChIKey | DNHNKXMDLJRGHR-UHFFFAOYSA-N |
| SMILES | C1=NN(C(=O)C(=C1Cl)Cl)CCC#N |
Computed by PubChem (NCBI)