Products 1629527-41-8
CAS 1629527-41-8 is the registry number for 2-(benzyloxy)-1,3-dichloro-5-methoxybenzene, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1,3-dichloro-5-methoxy-2-phenylmethoxybenzene (CAS 1629527-41-8) is a chemical compound with the molecular formula C14H12Cl2O2 and a molecular weight of 283.1 g/mol. IUPAC name: 1,3-dichloro-5-methoxy-2-phenylmethoxybenzene. InChIKey: LCQCHGARJZJRQO-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2O2 |
|---|---|
| Molecular weight | 283.1 g/mol |
| IUPAC name | 1,3-dichloro-5-methoxy-2-phenylmethoxybenzene |
| InChIKey | LCQCHGARJZJRQO-UHFFFAOYSA-N |
| SMILES | COC1=CC(=C(C(=C1)Cl)OCC2=CC=CC=C2)Cl |
Computed by PubChem (NCBI)