CAS 400825-70-9 is the registry number for (4-((2,4-Dichlorobenzyl)oxy)phenyl)methanol, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
[4-[(2,4-dichlorophenyl)methoxy]phenyl]methanol (CAS 400825-70-9) is a chemical compound with the molecular formula C14H12Cl2O2 and a molecular weight of 283.1 g/mol. IUPAC name: [4-[(2,4-dichlorophenyl)methoxy]phenyl]methanol. InChIKey: YIZSAETVNYHUOQ-UHFFFAOYSA-N.
| Molecular formula | C14H12Cl2O2 |
|---|---|
| Molecular weight | 283.1 g/mol |
| IUPAC name | [4-[(2,4-dichlorophenyl)methoxy]phenyl]methanol |
| InChIKey | YIZSAETVNYHUOQ-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1CO)OCC2=C(C=C(C=C2)Cl)Cl |
Computed by PubChem (NCBI)