Products 16296-47-2

CAS 16296-47-2 is the registry number for β–Alanine Orotic acid salt. Offered by: GLPBio. Available pack sizes: 100g, 25g.

Structural formula: {0} (CAS {1})

3-aminopropanoic acid;2,4-dioxo-1H-pyrimidine-6-carboxylic acid (CAS 16296-47-2) is a chemical compound with the molecular formula C8H11N3O6 and a molecular weight of 245.19 g/mol. IUPAC name: 3-aminopropanoic acid;2,4-dioxo-1H-pyrimidine-6-carboxylic acid. InChIKey: AGYNWVLHIMMOLB-UHFFFAOYSA-N.

Identity
Molecular formulaC8H11N3O6
Molecular weight245.19 g/mol
IUPAC name3-aminopropanoic acid;2,4-dioxo-1H-pyrimidine-6-carboxylic acid
InChIKeyAGYNWVLHIMMOLB-UHFFFAOYSA-N
SMILESC1=C(NC(=O)NC1=O)C(=O)O.C(CN)C(=O)O

Computed by PubChem (NCBI)