CAS 1629618-98-9 appears in our catalog under these names: Trenbolone Enanthate (1mg/ml in Acetonitrile), Trenbolone Enanthate, Trenbolone Enantate, Trenbolone enanthate 100 µg/mL in Acetonitrile. Offered by: TRC, Mikromol, Dr. Ehrenstorfer, Biosynth. Available pack sizes: 10x1ml, 100mg, 10mg, 250mg, 1ml, 2mg, 1mg, 5mg.
[(8S,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl] heptanoate (CAS 1629618-98-9) is a chemical compound with the molecular formula C25H34O3 and a molecular weight of 382.5 g/mol. IUPAC name: [(8S,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl] heptanoate. InChIKey: HGSFRISGULOJBX-FVEXOFTDSA-N.
| Molecular formula | C25H34O3 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | [(8S,13S,14S,17S)-13-methyl-3-oxo-2,6,7,8,14,15,16,17-octahydro-1H-cyclopenta[a]phenanthren-17-yl] heptanoate |
| InChIKey | HGSFRISGULOJBX-FVEXOFTDSA-N |
| SMILES | CCCCCCC(=O)O[C@H]1CC[C@@H]2[C@@]1(C=CC3=C4CCC(=O)C=C4CC[C@@H]23)C |
Computed by PubChem (NCBI)