Products 42815-59-8
CAS 42815-59-8 appears in our catalog under these names: 4-N-Butylbenzoic acid 4'-n-octyloxyphenyl ester, 95%, 4-(Octyloxy)phenyl 4-butylbenzoate, 98%, 4–(Octyloxy)phenyl 4–butylbenzoate, 4-n-Octyloxyphenyl 4-Butylbenzoate, >98.0%(GC), 4-(Octyloxy)phenyl 4-butylbenzoate, 98%, 98%. Offered by: Combi-blocks, AmBeed, GLPBio, TCI, Chemat. Available pack sizes: 250mg, 1g, 100mg.
(4-octoxyphenyl) 4-butylbenzoate (CAS 42815-59-8) is a chemical compound with the molecular formula C25H34O3 and a molecular weight of 382.5 g/mol. IUPAC name: (4-octoxyphenyl) 4-butylbenzoate. InChIKey: DESAJRHSCPKXHK-UHFFFAOYSA-N.
| Molecular formula | C25H34O3 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | (4-octoxyphenyl) 4-butylbenzoate |
| InChIKey | DESAJRHSCPKXHK-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOC1=CC=C(C=C1)OC(=O)C2=CC=C(C=C2)CCCC |
Computed by PubChem (NCBI)
Synonyms:
4-(octyloxy)phenyl 4-butylbenzoate, (4-octoxyphenyl) 4-butylbenzoate, 4-n-Octyloxyphenyl 4-Butylbenzoate, 4-n-Octyloxyphenyl 4-Butylbenzoate [Liquid Crystal], 4-N-Butylbenzoic acid 4'-N-octyloxyphenyl ester, 4Bzo8OP, 4-Butylbenzoic Acid 4-n-Octyloxyphenyl Ester, 4-(octyloxy)phenyl4-butylbenzoate, 4-n-Octyloxyphenyl 4-Butylbenzoate, 98%, 4-Butyl-benzoic acid 4-octyloxy-phenyl ester