Products 74479-40-6
CAS 74479-40-6 appears in our catalog under these names: Acitretin Impurity 2, Acitretin Impurity 18, Butyl ((2E,4E,6E,8E)-9-(4-Methoxy-2,3,6-trimethyl)phenyl-3,7-dimethylnona-2,4,6,8)tetraenoate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 5mg.
Butyl (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate (CAS 74479-40-6) is a chemical compound with the molecular formula C25H34O3 and a molecular weight of 382.5 g/mol. IUPAC name: butyl (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate. InChIKey: UZNLIQTXVFPNBK-KMGRWALASA-N.
| Molecular formula | C25H34O3 |
|---|---|
| Molecular weight | 382.5 g/mol |
| IUPAC name | butyl (2E,4E,6E,8E)-9-(4-methoxy-2,3,6-trimethylphenyl)-3,7-dimethylnona-2,4,6,8-tetraenoate |
| InChIKey | UZNLIQTXVFPNBK-KMGRWALASA-N |
| SMILES | CCCCOC(=O)/C=C(\C)/C=C/C=C(\C)/C=C/C1=C(C(=C(C=C1C)OC)C)C |
Computed by PubChem (NCBI)