CAS 2096331-20-1 appears in our catalog under these names: (4-(Cyclopentyloxy)-2,3-difluorophenyl)boronic acid, 97%, 97%, 4-(Cyclopentyloxy)-2,3-difluorophenylboronic acid, 97%, (4-(Cyclopentyloxy)-2,3-difluorophenyl)boronic acid, 97%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g.
(4-cyclopentyloxy-2,3-difluorophenyl)boronic acid (CAS 2096331-20-1) is a chemical compound with the molecular formula C11H13BF2O3 and a molecular weight of 242.03 g/mol. IUPAC name: (4-cyclopentyloxy-2,3-difluorophenyl)boronic acid. InChIKey: RDZDOQDFRSSUFS-UHFFFAOYSA-N.
| Molecular formula | C11H13BF2O3 |
|---|---|
| Molecular weight | 242.03 g/mol |
| IUPAC name | (4-cyclopentyloxy-2,3-difluorophenyl)boronic acid |
| InChIKey | RDZDOQDFRSSUFS-UHFFFAOYSA-N |
| SMILES | B(C1=C(C(=C(C=C1)OC2CCCC2)F)F)(O)O |
Computed by PubChem (NCBI)