CAS 1630742-73-2 is the registry number for 5-(2-Chloro-3,4-dimethoxyphenyl)-2H-1,2,3,4-tetrazole. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
5-(2-chloro-3,4-dimethoxyphenyl)-2H-tetrazole (CAS 1630742-73-2) is a chemical compound with the molecular formula C9H9ClN4O2 and a molecular weight of 240.64 g/mol. IUPAC name: 5-(2-chloro-3,4-dimethoxyphenyl)-2H-tetrazole. InChIKey: ZPTDKGDBPGLZGB-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4O2 |
|---|---|
| Molecular weight | 240.64 g/mol |
| IUPAC name | 5-(2-chloro-3,4-dimethoxyphenyl)-2H-tetrazole |
| InChIKey | ZPTDKGDBPGLZGB-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C=C1)C2=NNN=N2)Cl)OC |
Computed by PubChem (NCBI)