CAS 2768158-28-5 is the registry number for 2-Chloro-7-isopropyl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid (CAS 2768158-28-5) is a chemical compound with the molecular formula C9H9ClN4O2 and a molecular weight of 240.64 g/mol. IUPAC name: 2-chloro-7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid. InChIKey: XPUFZUHNVHKAHX-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4O2 |
|---|---|
| Molecular weight | 240.64 g/mol |
| IUPAC name | 2-chloro-7-propan-2-yl-[1,2,4]triazolo[1,5-a]pyrimidine-6-carboxylic acid |
| InChIKey | XPUFZUHNVHKAHX-UHFFFAOYSA-N |
| SMILES | CC(C)C1=C(C=NC2=NC(=NN12)Cl)C(=O)O |
Computed by PubChem (NCBI)