CAS 2445846-40-0 is the registry number for 5-Chloro-7-methoxy-1-(oxetan-3-yl)-1H-pyrazolo[4,3-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5-chloro-7-methoxy-1-(oxetan-3-yl)pyrazolo[4,5-d]pyrimidine (CAS 2445846-40-0) is a chemical compound with the molecular formula C9H9ClN4O2 and a molecular weight of 240.64 g/mol. IUPAC name: 5-chloro-7-methoxy-1-(oxetan-3-yl)pyrazolo[4,5-d]pyrimidine. InChIKey: ILVLLGBAMDKONG-UHFFFAOYSA-N.
| Molecular formula | C9H9ClN4O2 |
|---|---|
| Molecular weight | 240.64 g/mol |
| IUPAC name | 5-chloro-7-methoxy-1-(oxetan-3-yl)pyrazolo[4,5-d]pyrimidine |
| InChIKey | ILVLLGBAMDKONG-UHFFFAOYSA-N |
| SMILES | COC1=NC(=NC2=C1N(N=C2)C3COC3)Cl |
Computed by PubChem (NCBI)