Products 1630760-89-2
CAS 1630760-89-2 is the registry number for Levosimendan Impurity 42. Offered by: Chemat Brand. Available pack sizes: on request.
(4R)-4-methyl-3-phenyl-4,5-dihydro-1H-pyridazin-6-one (CAS 1630760-89-2) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: (4R)-4-methyl-3-phenyl-4,5-dihydro-1H-pyridazin-6-one. InChIKey: GVASAZMJZKWWEA-MRVPVSSYSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | (4R)-4-methyl-3-phenyl-4,5-dihydro-1H-pyridazin-6-one |
| InChIKey | GVASAZMJZKWWEA-MRVPVSSYSA-N |
| SMILES | C[C@@H]1CC(=O)NN=C1C2=CC=CC=C2 |
Computed by PubChem (NCBI)