CAS 2290570-69-1 appears in our catalog under these names: Levosimendan Impurity 13, Levosimendan Impurity 16, Dextrosimendan 6-Phenyl, >95% (HPLC). Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg, 250mg, 25mg.
(4S)-4-methyl-3-phenyl-4,5-dihydro-1H-pyridazin-6-one (CAS 2290570-69-1) is a chemical compound with the molecular formula C11H12N2O and a molecular weight of 188.23 g/mol. IUPAC name: (4S)-4-methyl-3-phenyl-4,5-dihydro-1H-pyridazin-6-one. InChIKey: GVASAZMJZKWWEA-QMMMGPOBSA-N.
| Molecular formula | C11H12N2O |
|---|---|
| Molecular weight | 188.23 g/mol |
| IUPAC name | (4S)-4-methyl-3-phenyl-4,5-dihydro-1H-pyridazin-6-one |
| InChIKey | GVASAZMJZKWWEA-QMMMGPOBSA-N |
| SMILES | C[C@H]1CC(=O)NN=C1C2=CC=CC=C2 |
Computed by PubChem (NCBI)