Products 1630763-65-3
CAS 1630763-65-3 is the registry number for 1-Amino-5-bromo-4,6-dimethyl-2-oxo-1,2-dihydropyridine-3-carbonitrile. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
1-amino-5-bromo-4,6-dimethyl-2-oxopyridine-3-carbonitrile (CAS 1630763-65-3) is a chemical compound with the molecular formula C8H8BrN3O and a molecular weight of 242.07 g/mol. IUPAC name: 1-amino-5-bromo-4,6-dimethyl-2-oxopyridine-3-carbonitrile. InChIKey: PALFUEIFGWFPDW-UHFFFAOYSA-N.
| Molecular formula | C8H8BrN3O |
|---|---|
| Molecular weight | 242.07 g/mol |
| IUPAC name | 1-amino-5-bromo-4,6-dimethyl-2-oxopyridine-3-carbonitrile |
| InChIKey | PALFUEIFGWFPDW-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N(C(=C1Br)C)N)C#N |
Computed by PubChem (NCBI)