Products 1630763-66-4

CAS 1630763-66-4 is the registry number for 2-(2-Methyl-4-oxo-1,4-dihydropyrimido[1,2-b]indazol-3-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.

Structural formula: {0} (CAS {1})

2-(2-methyl-4-oxo-6H-pyrimido[1,2-b]indazol-3-yl)acetic acid (CAS 1630763-66-4) is a chemical compound with the molecular formula C13H11N3O3 and a molecular weight of 257.24 g/mol. IUPAC name: 2-(2-methyl-4-oxo-6H-pyrimido[1,2-b]indazol-3-yl)acetic acid. InChIKey: VODRFXKBJGFIJD-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11N3O3
Molecular weight257.24 g/mol
IUPAC name2-(2-methyl-4-oxo-6H-pyrimido[1,2-b]indazol-3-yl)acetic acid
InChIKeyVODRFXKBJGFIJD-UHFFFAOYSA-N
SMILESCC1=C(C(=O)N2C(=N1)C3=CC=CC=C3N2)CC(=O)O

Computed by PubChem (NCBI)