CAS 1630763-66-4 is the registry number for 2-(2-Methyl-4-oxo-1,4-dihydropyrimido[1,2-b]indazol-3-yl)acetic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(2-methyl-4-oxo-6H-pyrimido[1,2-b]indazol-3-yl)acetic acid (CAS 1630763-66-4) is a chemical compound with the molecular formula C13H11N3O3 and a molecular weight of 257.24 g/mol. IUPAC name: 2-(2-methyl-4-oxo-6H-pyrimido[1,2-b]indazol-3-yl)acetic acid. InChIKey: VODRFXKBJGFIJD-UHFFFAOYSA-N.
| Molecular formula | C13H11N3O3 |
|---|---|
| Molecular weight | 257.24 g/mol |
| IUPAC name | 2-(2-methyl-4-oxo-6H-pyrimido[1,2-b]indazol-3-yl)acetic acid |
| InChIKey | VODRFXKBJGFIJD-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)N2C(=N1)C3=CC=CC=C3N2)CC(=O)O |
Computed by PubChem (NCBI)