Products 676643-01-9

CAS 676643-01-9 is the registry number for Ethyl 7-(2-furyl)pyrazolo(1,5-a)pyrimidine-3-carboxylate. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.

Structural formula: {0} (CAS {1})

Ethyl 7-(furan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carboxylate (CAS 676643-01-9) is a chemical compound with the molecular formula C13H11N3O3 and a molecular weight of 257.24 g/mol. IUPAC name: ethyl 7-(furan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carboxylate. InChIKey: ZHVOIYMOENNRBF-UHFFFAOYSA-N.

Identity
Molecular formulaC13H11N3O3
Molecular weight257.24 g/mol
IUPAC nameethyl 7-(furan-2-yl)pyrazolo[1,5-a]pyrimidine-3-carboxylate
InChIKeyZHVOIYMOENNRBF-UHFFFAOYSA-N
SMILESCCOC(=O)C1=C2N=CC=C(N2N=C1)C3=CC=CO3

Computed by PubChem (NCBI)